C23H23F6NO5 — CID 54585115
5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,4,8-trimethoxyphenanthridin-6-one (PubChem CID 54585115) has the molecular formula C23H23F6NO5 and a molecular weight of 507.43 g/mol. Its IUPAC name is 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,4,8-trimethoxyphenanthridin-6-one.
| Compound Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,4,8-trimethoxyphenanthridin-6-one |
|---|---|
| PubChem CID | 54585115 |
| Molecular Formula | C23H23F6NO5 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,4,8-trimethoxyphenanthridin-6-one |
| SMILES | CCCCn1c(=O)c2cc(OC)ccc2c2c(OC)c(C(O)(C(F)(F)F)C(F)(F)F)cc(OC)c21 |
| InChI | InChI=1S/C23H23F6NO5/c1-5-6-9-30-18-16(34-3)11-15(21(32,22(24,25)26)23(27,28)29)19(35-4)17(18)13-8-7-12(33-2)10-14(13)20(30)31/h7-8,10-11,32H,5-6,9H2,1-4H3 |
| InChIKey | LYFLWSAVNZXZGH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|