C23H27NS — CID 54585143
(1S,9aR)-1-(9H-thioxanthen-9-ylmethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 54585143) has the molecular formula C23H27NS and a molecular weight of 349.54 g/mol. Its IUPAC name is (1S,9aR)-1-(9H-thioxanthen-9-ylmethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1S,9aR)-1-(9H-thioxanthen-9-ylmethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 54585143 |
| Molecular Formula | C23H27NS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (1S,9aR)-1-(9H-thioxanthen-9-ylmethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | c1ccc2c(c1)Sc1ccccc1C2C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C23H27NS/c1-3-12-22-18(9-1)20(19-10-2-4-13-23(19)25-22)16-17-8-7-15-24-14-6-5-11-21(17)24/h1-4,9-10,12-13,17,20-21H,5-8,11,14-16H2/t17-,21+/m0/s1 |
| InChIKey | WVOUDCCPOUYBDE-LAUBAEHRSA-N |
| XLogP | 5.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |