C32H40N5O4+ — CID 54585321
N,N-dibutyl-1-[3-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]propyl]triazol-4-amine (PubChem CID 54585321) has the molecular formula C32H40N5O4+ and a molecular weight of 558.70 g/mol. Its IUPAC name is N,N-dibutyl-1-[3-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]propyl]triazol-4-amine.
| Compound Name | N,N-dibutyl-1-[3-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]propyl]triazol-4-amine |
|---|---|
| PubChem CID | 54585321 |
| Molecular Formula | C32H40N5O4+ |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | N,N-dibutyl-1-[3-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]propyl]triazol-4-amine |
| SMILES | CCCCN(CCCC)c1cn(CCCOc2c(OC)ccc3cc4[n+](cc23)CCc2cc3c(cc2-4)OCO3)nn1 |
| InChI | InChI=1S/C32H40N5O4/c1-4-6-12-35(13-7-5-2)31-21-37(34-33-31)14-8-16-39-32-26-20-36-15-11-24-18-29-30(41-22-40-29)19-25(24)27(36)17-23(26)9-10-28(32)38-3/h9-10,17-21H,4-8,11-16,22H2,1-3H3/q+1 |
| InChIKey | YJGOHJCPIBSWCH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|