C27H36N2O2 — CID 54585396
1'-[3-[[(2R)-1-benzylpyrrolidin-2-yl]methoxy]propyl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 54585396) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1'-[3-[[(2R)-1-benzylpyrrolidin-2-yl]methoxy]propyl]spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[3-[[(2R)-1-benzylpyrrolidin-2-yl]methoxy]propyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 54585396 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1'-[3-[[(2R)-1-benzylpyrrolidin-2-yl]methoxy]propyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | c1ccc(CN2CCC[C@@H]2COCCCN2CCC3(CC2)OCc2ccccc23)cc1 |
| InChI | InChI=1S/C27H36N2O2/c1-2-8-23(9-3-1)20-29-16-6-11-25(29)22-30-19-7-15-28-17-13-27(14-18-28)26-12-5-4-10-24(26)21-31-27/h1-5,8-10,12,25H,6-7,11,13-22H2/t25-/m1/s1 |
| InChIKey | SKYILIFVZPTOLI-RUZDIDTESA-N |
| XLogP | 4.58 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|