About 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine
3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 54585414) has the molecular formula C15H15N5O2
and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 54585414 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)n1nc(-c2ccc3c(c2)OCO3)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H15N5O2/c1-8(2)20-15-12(14(16)17-6-18-15)13(19-20)9-3-4-10-11(5-9)22-7-21-10/h3-6,8H,7H2,1-2H3,(H2,16,17,18) |
| InChIKey | PNBDCDXPQZPIPK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CID 54585414) is 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is CC(C)n1nc(-c2ccc3c(c2)OCO3)c2c(N)ncnc21.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is PNBDCDXPQZPIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O2/c1-8(2)20-15-12(14(16)17-6-18-15)13(19-20)9-3-4-10-11(5-9)22-7-21-10/h3-6,8H,7H2,1-2H3,(H2,16,17,18).
What are the key properties of 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 297.32 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 54585414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).