C21H21F3N6O2 — CID 54585462
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(benzotriazol-1-ylmethyl)piperazin-2-one (PubChem CID 54585462) has the molecular formula C21H21F3N6O2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(benzotriazol-1-ylmethyl)piperazin-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(benzotriazol-1-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 54585462 |
| Molecular Formula | C21H21F3N6O2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(benzotriazol-1-ylmethyl)piperazin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(Cn2nnc3ccccc32)C(=O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H21F3N6O2/c22-15-10-17(24)16(23)8-13(15)7-14(25)9-20(31)28-5-6-29(21(32)11-28)12-30-19-4-2-1-3-18(19)26-27-30/h1-4,8,10,14H,5-7,9,11-12,25H2/t14-/m1/s1 |
| InChIKey | CUNRIPAQGSEDEQ-CQSZACIVSA-N |
| XLogP | 1.44 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|