C24H27ClF2O4S2 — CID 54585575
(6aS,10aR)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6a-(2-propan-2-ylsulfanylethoxy)-7,8,9,10-tetrahydro-6H-benzo[c]chromene (PubChem CID 54585575) has the molecular formula C24H27ClF2O4S2 and a molecular weight of 517.06 g/mol. Its IUPAC name is (6aS,10aR)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6a-(2-propan-2-ylsulfanylethoxy)-7,8,9,10-tetrahydro-6H-benzo[c]chromene.
| Compound Name | (6aS,10aR)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6a-(2-propan-2-ylsulfanylethoxy)-7,8,9,10-tetrahydro-6H-benzo[c]chromene |
|---|---|
| PubChem CID | 54585575 |
| Molecular Formula | C24H27ClF2O4S2 |
| Molecular Weight | 517.06 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (6aS,10aR)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6a-(2-propan-2-ylsulfanylethoxy)-7,8,9,10-tetrahydro-6H-benzo[c]chromene |
| SMILES | CC(C)SCCO[C@]12CCCC[C@@]1(S(=O)(=O)c1ccc(Cl)cc1)c1c(F)ccc(F)c1OC2 |
| InChI | InChI=1S/C24H27ClF2O4S2/c1-16(2)32-14-13-31-23-11-3-4-12-24(23,33(28,29)18-7-5-17(25)6-8-18)21-19(26)9-10-20(27)22(21)30-15-23/h5-10,16H,3-4,11-15H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | SQPRYBHWIRAAFH-BJKOFHAPSA-N |
| XLogP | 6.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|