C37H41N5O4 — CID 54585606
(E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-ethylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54585606) has the molecular formula C37H41N5O4 and a molecular weight of 619.77 g/mol. Its IUPAC name is (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-ethylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-ethylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54585606 |
| Molecular Formula | C37H41N5O4 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-ethylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CCN1CC[C@@](NC(=O)c2ccc3c(C4CCCCC4)c(-c4ccccn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)C1 |
| InChI | InChI=1S/C37H41N5O4/c1-3-42-22-20-37(24-42,36(46)39-28-16-12-25(13-17-28)14-19-32(43)44)40-35(45)27-15-18-29-31(23-27)41(2)34(30-11-7-8-21-38-30)33(29)26-9-5-4-6-10-26/h7-8,11-19,21,23,26H,3-6,9-10,20,22,24H2,1-2H3,(H,39,46)(H,40,45)(H,43,44)/b19-14+/t37-/m0/s1 |
| InChIKey | QIQTZKWHBRFSDT-PCHOQTRTSA-N |
| XLogP | 6.22 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|