C26H26ClF2N3 — CID 54585705
8-fluoro-5-(4-fluorophenyl)-2-(4-pyridin-4-ylbutyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 54585705) has the molecular formula C26H26ClF2N3 and a molecular weight of 453.96 g/mol. Its IUPAC name is 8-fluoro-5-(4-fluorophenyl)-2-(4-pyridin-4-ylbutyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride.
| Compound Name | 8-fluoro-5-(4-fluorophenyl)-2-(4-pyridin-4-ylbutyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 54585705 |
| Molecular Formula | C26H26ClF2N3 |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 8-fluoro-5-(4-fluorophenyl)-2-(4-pyridin-4-ylbutyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.Fc1ccc(-n2c3c(c4cc(F)ccc42)CN(CCCCc2ccncc2)CC3)cc1 |
| InChI | InChI=1S/C26H25F2N3.ClH/c27-20-4-7-22(8-5-20)31-25-9-6-21(28)17-23(25)24-18-30(16-12-26(24)31)15-2-1-3-19-10-13-29-14-11-19;/h4-11,13-14,17H,1-3,12,15-16,18H2;1H |
| InChIKey | RBVCYINXRFYUGY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|