About N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide
N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide (PubChem CID 54585822) has the molecular formula C21H23ClIN3O
and a molecular weight of 495.79 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide.
Molecular Properties
| Compound Name | N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide |
| PubChem CID | 54585822 |
| Molecular Formula | C21H23ClIN3O |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide |
| SMILES | CCn1c(C=CN(C(C)=O)c2ccccc2)[n+](CC)c2ccc(Cl)cc21.[I-] |
| InChI | InChI=1S/C21H23ClN3O.HI/c1-4-23-19-12-11-17(22)15-20(19)24(5-2)21(23)13-14-25(16(3)26)18-9-7-6-8-10-18;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ROTCVUPCQRVLOS-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide?
The IUPAC name of N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide (CID 54585822) is N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide.
What is the SMILES notation for N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide?
The canonical SMILES for N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide is CCn1c(C=CN(C(C)=O)c2ccccc2)[n+](CC)c2ccc(Cl)cc21.[I-].
What is the InChIKey of N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide?
The InChIKey is ROTCVUPCQRVLOS-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H23ClN3O.HI/c1-4-23-19-12-11-17(22)15-20(19)24(5-2)21(23)13-14-25(16(3)26)18-9-7-6-8-10-18;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1.
What are the key properties of N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide?
N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide has a molecular weight of 495.79 g/mol, XLogP of 1.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-chloro-1,3-diethylbenzimidazol-1-ium-2-yl)ethenyl]-N-phenylacetamide iodide is sourced from PubChem (CID 54585822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).