C30H35FN2O9 — CID 54585979
bis((Z)-but-2-enedioic acid);2-[4-[3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]ethanol (PubChem CID 54585979) has the molecular formula C30H35FN2O9 and a molecular weight of 586.61 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-[4-[3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]ethanol.
| Compound Name | bis((Z)-but-2-enedioic acid);2-[4-[3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 54585979 |
| Molecular Formula | C30H35FN2O9 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-[4-[3-(4-fluorophenyl)-5-methyl-2,3-dihydro-1H-inden-1-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1ccc2c(c1)C(c1ccc(F)cc1)CC2N1CCN(CCO)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H27FN2O.2C4H4O4/c1-16-2-7-19-21(14-16)20(17-3-5-18(23)6-4-17)15-22(19)25-10-8-24(9-11-25)12-13-26;2*5-3(6)1-2-4(7)8/h2-7,14,20,22,26H,8-13,15H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | GWSOCLDXSGWQNI-SPIKMXEPSA-N |
| XLogP | 2.74 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|