C36H39N3O5 — CID 54586028
(Z)-but-2-enedioic acid;4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)butanamide (PubChem CID 54586028) has the molecular formula C36H39N3O5 and a molecular weight of 593.72 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)butanamide.
| Compound Name | (Z)-but-2-enedioic acid;4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)butanamide |
|---|---|
| PubChem CID | 54586028 |
| Molecular Formula | C36H39N3O5 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)butanamide |
| SMILES | O=C(CCCN1CCN(C/C=C/c2ccccc2)CC1)NC1c2ccccc2C=Cc2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C32H35N3O.C4H4O4/c36-31(33-32-29-15-6-4-13-27(29)18-19-28-14-5-7-16-30(28)32)17-9-21-35-24-22-34(23-25-35)20-8-12-26-10-2-1-3-11-26;5-3(6)1-2-4(7)8/h1-8,10-16,18-19,32H,9,17,20-25H2,(H,33,36);1-2H,(H,5,6)(H,7,8)/b12-8+;2-1- |
| InChIKey | ZFQASWGIJWYUPX-CGMXWGGTSA-N |
| XLogP | 5.20 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|