C21H24OS2 — CID 54586037
(2'E)-8'a-methyl-2'-[(4-methylphenyl)methylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54586037) has the molecular formula C21H24OS2 and a molecular weight of 356.56 g/mol. Its IUPAC name is (2'E)-8'a-methyl-2'-[(4-methylphenyl)methylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-8'a-methyl-2'-[(4-methylphenyl)methylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54586037 |
| Molecular Formula | C21H24OS2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2'E)-8'a-methyl-2'-[(4-methylphenyl)methylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | Cc1ccc(/C=C2\CCC3=CC4(CCC3(C)C2=O)SCCS4)cc1 |
| InChI | InChI=1S/C21H24OS2/c1-15-3-5-16(6-4-15)13-17-7-8-18-14-21(23-11-12-24-21)10-9-20(18,2)19(17)22/h3-6,13-14H,7-12H2,1-2H3/b17-13+ |
| InChIKey | AFKOCTGKVSLVCH-GHRIWEEISA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|