C22H24OS2 — CID 54586065
(2'E)-8'a-methyl-2'-[(E)-3-phenylprop-2-enylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54586065) has the molecular formula C22H24OS2 and a molecular weight of 368.57 g/mol. Its IUPAC name is (2'E)-8'a-methyl-2'-[(E)-3-phenylprop-2-enylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-8'a-methyl-2'-[(E)-3-phenylprop-2-enylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54586065 |
| Molecular Formula | C22H24OS2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2'E)-8'a-methyl-2'-[(E)-3-phenylprop-2-enylidene]spiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CC12CCC3(C=C1CC/C(=C\C=C\c1ccccc1)C2=O)SCCS3 |
| InChI | InChI=1S/C22H24OS2/c1-21-12-13-22(24-14-15-25-22)16-19(21)11-10-18(20(21)23)9-5-8-17-6-3-2-4-7-17/h2-9,16H,10-15H2,1H3/b8-5+,18-9+ |
| InChIKey | JFRKMCVUMGBDCG-HYZSBJHASA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|