C22H27NOS2 — CID 54586066
(2'E)-2'-[[4-(dimethylamino)phenyl]methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54586066) has the molecular formula C22H27NOS2 and a molecular weight of 385.60 g/mol. Its IUPAC name is (2'E)-2'-[[4-(dimethylamino)phenyl]methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-2'-[[4-(dimethylamino)phenyl]methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54586066 |
| Molecular Formula | C22H27NOS2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2'E)-2'-[[4-(dimethylamino)phenyl]methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CN(C)c1ccc(/C=C2\CCC3=CC4(CCC3(C)C2=O)SCCS4)cc1 |
| InChI | InChI=1S/C22H27NOS2/c1-21-10-11-22(25-12-13-26-22)15-18(21)7-6-17(20(21)24)14-16-4-8-19(9-5-16)23(2)3/h4-5,8-9,14-15H,6-7,10-13H2,1-3H3/b17-14+ |
| InChIKey | ULJJBXSNFCMXQU-SAPNQHFASA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|