C27H17F6NO2 — CID 54586084
2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(naphthalen-2-ylmethyl)phenanthridin-6-one (PubChem CID 54586084) has the molecular formula C27H17F6NO2 and a molecular weight of 501.43 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(naphthalen-2-ylmethyl)phenanthridin-6-one.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(naphthalen-2-ylmethyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 54586084 |
| Molecular Formula | C27H17F6NO2 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(naphthalen-2-ylmethyl)phenanthridin-6-one |
| SMILES | O=c1c2ccccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2n1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H17F6NO2/c28-26(29,30)25(36,27(31,32)33)19-11-12-23-22(14-19)20-7-3-4-8-21(20)24(35)34(23)15-16-9-10-17-5-1-2-6-18(17)13-16/h1-14,36H,15H2 |
| InChIKey | SNUBGTSSORCULQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|