About 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile
3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile (PubChem CID 54586230) has the molecular formula C13H7IN2S
and a molecular weight of 350.18 g/mol. Its IUPAC name is 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile.
Molecular Properties
| Compound Name | 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile |
| PubChem CID | 54586230 |
| Molecular Formula | C13H7IN2S |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile |
| SMILES | Cc1nc(C#Cc2cc(I)cc(C#N)c2)cs1 |
| InChI | InChI=1S/C13H7IN2S/c1-9-16-13(8-17-9)3-2-10-4-11(7-15)6-12(14)5-10/h4-6,8H,1H3 |
| InChIKey | GEBAHYAEJWVOES-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile?
The IUPAC name of 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile (CID 54586230) is 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile.
What is the SMILES notation for 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile?
The canonical SMILES for 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile is Cc1nc(C#Cc2cc(I)cc(C#N)c2)cs1.
What is the InChIKey of 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile?
The InChIKey is GEBAHYAEJWVOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7IN2S/c1-9-16-13(8-17-9)3-2-10-4-11(7-15)6-12(14)5-10/h4-6,8H,1H3.
What are the key properties of 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile?
3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile has a molecular weight of 350.18 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile is sourced from PubChem (CID 54586230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).