C20H32O2 — CID 54586241
2-[(1R,4E,6E,10E,14S)-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propan-2-ol (PubChem CID 54586241) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-[(1R,4E,6E,10E,14S)-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propan-2-ol.
| Compound Name | 2-[(1R,4E,6E,10E,14S)-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 54586241 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-[(1R,4E,6E,10E,14S)-4,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-7-yl]propan-2-ol |
| SMILES | C/C1=C\CC[C@]2(C)O[C@@H]2CC/C(C)=C/C=C(/C(C)(C)O)CC1 |
| InChI | InChI=1S/C20H32O2/c1-15-7-6-14-20(5)18(22-20)13-10-16(2)9-12-17(11-8-15)19(3,4)21/h7,9,12,18,21H,6,8,10-11,13-14H2,1-5H3/b15-7+,16-9+,17-12+/t18-,20+/m1/s1 |
| InChIKey | OAWYUCSBLMUTFD-IHYVIKNBSA-N |
| XLogP | 5.09 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|