About 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione
6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 54586247) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione.
Molecular Properties
| Compound Name | 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione |
| PubChem CID | 54586247 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CN(C)CCn1c2c(c3ccccc3c1=O)C(=O)c1ccc(O)cc1-2 |
| InChI | InChI=1S/C20H18N2O3/c1-21(2)9-10-22-18-16-11-12(23)7-8-14(16)19(24)17(18)13-5-3-4-6-15(13)20(22)25/h3-8,11,23H,9-10H2,1-2H3 |
| InChIKey | RGXAQFZVXRJMOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione?
The IUPAC name of 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione (CID 54586247) is 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione.
What is the SMILES notation for 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione?
The canonical SMILES for 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione is CN(C)CCn1c2c(c3ccccc3c1=O)C(=O)c1ccc(O)cc1-2.
What is the InChIKey of 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione?
The InChIKey is RGXAQFZVXRJMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-21(2)9-10-22-18-16-11-12(23)7-8-14(16)19(24)17(18)13-5-3-4-6-15(13)20(22)25/h3-8,11,23H,9-10H2,1-2H3.
What are the key properties of 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione?
6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione has a molecular weight of 334.38 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(dimethylamino)ethyl]-8-hydroxyindeno[1,2-c]isoquinoline-5,11-dione is sourced from PubChem (CID 54586247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).