C30H32Cl2N2O — CID 54586271
7-chloro-6-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline (PubChem CID 54586271) has the molecular formula C30H32Cl2N2O and a molecular weight of 507.51 g/mol. Its IUPAC name is 7-chloro-6-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline.
| Compound Name | 7-chloro-6-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 54586271 |
| Molecular Formula | C30H32Cl2N2O |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 7-chloro-6-(4-chlorophenyl)-3-(3,5-dimethylphenyl)-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline |
| SMILES | Cc1cc(C)cc(C2=C(OCCC3CCCCN3)c3cc(-c4ccc(Cl)cc4)c(Cl)cc3NC2)c1 |
| InChI | InChI=1S/C30H32Cl2N2O/c1-19-13-20(2)15-22(14-19)27-18-34-29-17-28(32)25(21-6-8-23(31)9-7-21)16-26(29)30(27)35-12-10-24-5-3-4-11-33-24/h6-9,13-17,24,33-34H,3-5,10-12,18H2,1-2H3 |
| InChIKey | YWHXYUQIWYAANP-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|