C30H33ClN2O — CID 54586272
7-chloro-3-(3,5-dimethylphenyl)-6-phenyl-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline (PubChem CID 54586272) has the molecular formula C30H33ClN2O and a molecular weight of 473.06 g/mol. Its IUPAC name is 7-chloro-3-(3,5-dimethylphenyl)-6-phenyl-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline.
| Compound Name | 7-chloro-3-(3,5-dimethylphenyl)-6-phenyl-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline |
|---|---|
| PubChem CID | 54586272 |
| Molecular Formula | C30H33ClN2O |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 7-chloro-3-(3,5-dimethylphenyl)-6-phenyl-4-(2-piperidin-2-ylethoxy)-1,2-dihydroquinoline |
| SMILES | Cc1cc(C)cc(C2=C(OCCC3CCCCN3)c3cc(-c4ccccc4)c(Cl)cc3NC2)c1 |
| InChI | InChI=1S/C30H33ClN2O/c1-20-14-21(2)16-23(15-20)27-19-33-29-18-28(31)25(22-8-4-3-5-9-22)17-26(29)30(27)34-13-11-24-10-6-7-12-32-24/h3-5,8-9,14-18,24,32-33H,6-7,10-13,19H2,1-2H3 |
| InChIKey | MRYYDCIBVWPZNW-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|