C20H20N6O3 — CID 54586329
4-N-(1H-indazol-6-yl)-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 54586329) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-N-(1H-indazol-6-yl)-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-6-yl)-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 54586329 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-N-(1H-indazol-6-yl)-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2nccc(Nc3ccc4cn[nH]c4c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N6O3/c1-27-16-9-14(10-17(28-2)19(16)29-3)24-20-21-7-6-18(25-20)23-13-5-4-12-11-22-26-15(12)8-13/h4-11H,1-3H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | SAAKKJZLPDZALH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |