C20H15N3O5 — CID 54586379
16-(4-methoxy-3-nitrophenyl)-13-oxa-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one (PubChem CID 54586379) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 16-(4-methoxy-3-nitrophenyl)-13-oxa-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one.
| Compound Name | 16-(4-methoxy-3-nitrophenyl)-13-oxa-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one |
|---|---|
| PubChem CID | 54586379 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 16-(4-methoxy-3-nitrophenyl)-13-oxa-3,10-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),4,7,11(15)-pentaen-14-one |
| SMILES | COc1ccc(C2C3=C(COC3=O)Nc3ccc4cc[nH]c4c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15N3O5/c1-27-15-5-3-11(8-14(15)23(25)26)16-17-12(4-2-10-6-7-21-19(10)17)22-13-9-28-20(24)18(13)16/h2-8,16,21-22H,9H2,1H3 |
| InChIKey | OADWSBYEDFEICH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|