C21H20N4O — CID 54586394
4-benzyl-7-methyl-3,4,11,12-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,10,13,15-pentaen-5-one (PubChem CID 54586394) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-benzyl-7-methyl-3,4,11,12-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,10,13,15-pentaen-5-one.
| Compound Name | 4-benzyl-7-methyl-3,4,11,12-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,10,13,15-pentaen-5-one |
|---|---|
| PubChem CID | 54586394 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-benzyl-7-methyl-3,4,11,12-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,10,13,15-pentaen-5-one |
| SMILES | CC12CCc3nn4ccccc4c3C1=NN(Cc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C21H20N4O/c1-21-11-10-16-19(17-9-5-6-12-24(17)22-16)20(21)23-25(18(26)13-21)14-15-7-3-2-4-8-15/h2-9,12H,10-11,13-14H2,1H3 |
| InChIKey | FUHDPTQIFZAVRJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |