C21H21ClF3N3O2 — CID 54586435
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-chlorophenyl)methyl]piperazin-2-one (PubChem CID 54586435) has the molecular formula C21H21ClF3N3O2 and a molecular weight of 439.87 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-chlorophenyl)methyl]piperazin-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-chlorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 54586435 |
| Molecular Formula | C21H21ClF3N3O2 |
| Molecular Weight | 439.87 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-[(2-chlorophenyl)methyl]piperazin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(Cc2ccccc2Cl)C(=O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H21ClF3N3O2/c22-16-4-2-1-3-13(16)11-27-5-6-28(12-21(27)30)20(29)9-15(26)7-14-8-18(24)19(25)10-17(14)23/h1-4,8,10,15H,5-7,9,11-12,26H2/t15-/m1/s1 |
| InChIKey | IPJNTMRIXXBAIG-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|