About 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid
3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid (PubChem CID 54586499) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid |
| PubChem CID | 54586499 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid |
| SMILES | CCCCCN1C(=O)C(CCC(=O)O)(c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C23H25NO5/c1-2-3-6-13-24-18-8-5-4-7-17(18)23(22(24)27,12-11-21(25)26)16-9-10-19-20(14-16)29-15-28-19/h4-5,7-10,14H,2-3,6,11-13,15H2,1H3,(H,25,26) |
| InChIKey | DOOGLNMQEADVFA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid?
The IUPAC name of 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid (CID 54586499) is 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid.
What is the SMILES notation for 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid?
The canonical SMILES for 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid is CCCCCN1C(=O)C(CCC(=O)O)(c2ccc3c(c2)OCO3)c2ccccc21.
What is the InChIKey of 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid?
The InChIKey is DOOGLNMQEADVFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO5/c1-2-3-6-13-24-18-8-5-4-7-17(18)23(22(24)27,12-11-21(25)26)16-9-10-19-20(14-16)29-15-28-19/h4-5,7-10,14H,2-3,6,11-13,15H2,1H3,(H,25,26).
What are the key properties of 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid?
3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid has a molecular weight of 395.46 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,3-benzodioxol-5-yl)-2-oxo-1-pentylindol-3-yl]propanoic acid is sourced from PubChem (CID 54586499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).