C23H27N3OS — CID 54586543
N-[3-(diethylamino)propyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 54586543) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 54586543 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3OS/c1-3-26(4-2)17-11-16-24-22(27)21-20(18-12-7-5-8-13-18)25-23(28-21)19-14-9-6-10-15-19/h5-10,12-15H,3-4,11,16-17H2,1-2H3,(H,24,27) |
| InChIKey | XIEYBIZSABYVGD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|