About 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride
4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride (PubChem CID 54586590) has the molecular formula C14H14BrClN2O2S
and a molecular weight of 389.70 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride |
| PubChem CID | 54586590 |
| Molecular Formula | C14H14BrClN2O2S |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride |
| SMILES | CN1Cc2sc([N+](=O)[O-])cc2C(c2ccc(Br)cc2)C1.Cl |
| InChI | InChI=1S/C14H13BrN2O2S.ClH/c1-16-7-12(9-2-4-10(15)5-3-9)11-6-14(17(18)19)20-13(11)8-16;/h2-6,12H,7-8H2,1H3;1H |
| InChIKey | VKNYYAMHMNIJPR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The IUPAC name of 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride (CID 54586590) is 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride.
What is the SMILES notation for 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The canonical SMILES for 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride is CN1Cc2sc([N+](=O)[O-])cc2C(c2ccc(Br)cc2)C1.Cl.
What is the InChIKey of 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The InChIKey is VKNYYAMHMNIJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2O2S.ClH/c1-16-7-12(9-2-4-10(15)5-3-9)11-6-14(17(18)19)20-13(11)8-16;/h2-6,12H,7-8H2,1H3;1H.
What are the key properties of 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride has a molecular weight of 389.70 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-6-methyl-2-nitro-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride is sourced from PubChem (CID 54586590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).