C32H34N4O4S — CID 54586631
(E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54586631) has the molecular formula C32H34N4O4S and a molecular weight of 570.72 g/mol. Its IUPAC name is (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54586631 |
| Molecular Formula | C32H34N4O4S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(-c2nccs2)c(C2CCCCC2)c2ccc(C(=O)NC(C)(C)C(=O)Nc3ccc(/C=C/C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C32H34N4O4S/c1-32(2,31(40)34-23-13-9-20(10-14-23)11-16-26(37)38)35-29(39)22-12-15-24-25(19-22)36(3)28(30-33-17-18-41-30)27(24)21-7-5-4-6-8-21/h9-19,21H,4-8H2,1-3H3,(H,34,40)(H,35,39)(H,37,38)/b16-11+ |
| InChIKey | WHUWIKZMRDZOBV-LFIBNONCSA-N |
| XLogP | 6.59 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|