C22H21Cl2N3 — CID 54586688
8-chloro-2-(2-quinolin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride (PubChem CID 54586688) has the molecular formula C22H21Cl2N3 and a molecular weight of 398.34 g/mol. Its IUPAC name is 8-chloro-2-(2-quinolin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride.
| Compound Name | 8-chloro-2-(2-quinolin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 54586688 |
| Molecular Formula | C22H21Cl2N3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 8-chloro-2-(2-quinolin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.Clc1ccc2[nH]c3c(c2c1)CN(CCc1ccc2ccccc2n1)CC3 |
| InChI | InChI=1S/C22H20ClN3.ClH/c23-16-6-8-21-18(13-16)19-14-26(12-10-22(19)25-21)11-9-17-7-5-15-3-1-2-4-20(15)24-17;/h1-8,13,25H,9-12,14H2;1H |
| InChIKey | GCTQDSJQYQZLLG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|