C31H34BrF3N2O2 — CID 54586744
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide (PubChem CID 54586744) has the molecular formula C31H34BrF3N2O2 and a molecular weight of 603.52 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide |
|---|---|
| PubChem CID | 54586744 |
| Molecular Formula | C31H34BrF3N2O2 |
| Molecular Weight | 603.52 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate bromide |
| SMILES | Cc1cccc(N(Cc2cc(F)c(F)cc2F)C(=O)O[C@H]2C[N+]3(CCCc4ccccc4)CCC2CC3)c1.[Br-] |
| InChI | InChI=1S/C31H34F3N2O2.BrH/c1-22-7-5-11-26(17-22)35(20-25-18-28(33)29(34)19-27(25)32)31(37)38-30-21-36(15-12-24(30)13-16-36)14-6-10-23-8-3-2-4-9-23;/h2-5,7-9,11,17-19,24,30H,6,10,12-16,20-21H2,1H3;1H/q+1;/p-1/t24?,30-,36?;/m0./s1 |
| InChIKey | QKWOYWROMVNAEX-QKIIOBKNSA-M |
| XLogP | 3.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|