C24H35N3O4S — CID 54586756
(2S)-N-[3-(dimethylamino)propyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 54586756) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is (2S)-N-[3-(dimethylamino)propyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[3-(dimethylamino)propyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54586756 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-N-[3-(dimethylamino)propyl]-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)NCCCN(C)C)c(C)c1C |
| InChI | InChI=1S/C24H35N3O4S/c1-17-15-22(31-6)18(2)19(3)23(17)32(29,30)26-21(16-20-11-8-7-9-12-20)24(28)25-13-10-14-27(4)5/h7-9,11-12,15,21,26H,10,13-14,16H2,1-6H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | VYTGZTHGKWQSCL-NRFANRHFSA-N |
| XLogP | 2.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|