About cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium
cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium (PubChem CID 54586770) has the molecular formula C10H10N6O2
and a molecular weight of 246.23 g/mol. Its IUPAC name is cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium.
Molecular Properties
| Compound Name | cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium |
| PubChem CID | 54586770 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium |
| SMILES | Cc1cc(-c2nn(C)c(C)c2/[N+]([O-])=N/C#N)on1 |
| InChI | InChI=1S/C10H10N6O2/c1-6-4-8(18-14-6)9-10(16(17)12-5-11)7(2)15(3)13-9/h4H,1-3H3/b16-12- |
| InChIKey | OVNPHYXNWCPWGE-VBKFSLOCSA-N |
| XLogP | 1.77 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium?
The IUPAC name of cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium (CID 54586770) is cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium.
What is the SMILES notation for cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium?
The canonical SMILES for cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium is Cc1cc(-c2nn(C)c(C)c2/[N+]([O-])=N/C#N)on1.
What is the InChIKey of cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium?
The InChIKey is OVNPHYXNWCPWGE-VBKFSLOCSA-N. The full InChI is InChI=1S/C10H10N6O2/c1-6-4-8(18-14-6)9-10(16(17)12-5-11)7(2)15(3)13-9/h4H,1-3H3/b16-12-.
What are the key properties of cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium?
cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium has a molecular weight of 246.23 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for cyanoimino-[1,5-dimethyl-3-(3-methyl-1,2-oxazol-5-yl)pyrazol-4-yl]-oxidoazanium is sourced from PubChem (CID 54586770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).