C22H29N3O3 — CID 54586773
3-[2-(dimethylamino)ethyl]-1-(7-hydroxyheptyl)pyrrolo[3,2-g]isoquinoline-4,9-dione (PubChem CID 54586773) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1-(7-hydroxyheptyl)pyrrolo[3,2-g]isoquinoline-4,9-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1-(7-hydroxyheptyl)pyrrolo[3,2-g]isoquinoline-4,9-dione |
|---|---|
| PubChem CID | 54586773 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1-(7-hydroxyheptyl)pyrrolo[3,2-g]isoquinoline-4,9-dione |
| SMILES | CN(C)CCc1cn(CCCCCCCO)c2c1C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C22H29N3O3/c1-24(2)12-9-16-15-25(11-6-4-3-5-7-13-26)20-19(16)21(27)17-8-10-23-14-18(17)22(20)28/h8,10,14-15,26H,3-7,9,11-13H2,1-2H3 |
| InChIKey | PVSBTDWZNODVHT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|