C23H29BrCl2N2O — CID 54586839
7-bromo-N-[(1-hydroxy-2,2,6,6-tetramethyl-3H-pyridin-4-yl)methyl]-9H-fluoren-2-amine;dihydrochloride (PubChem CID 54586839) has the molecular formula C23H29BrCl2N2O and a molecular weight of 500.31 g/mol. Its IUPAC name is 7-bromo-N-[(1-hydroxy-2,2,6,6-tetramethyl-3H-pyridin-4-yl)methyl]-9H-fluoren-2-amine;dihydrochloride.
| Compound Name | 7-bromo-N-[(1-hydroxy-2,2,6,6-tetramethyl-3H-pyridin-4-yl)methyl]-9H-fluoren-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 54586839 |
| Molecular Formula | C23H29BrCl2N2O |
| Molecular Weight | 500.31 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 7-bromo-N-[(1-hydroxy-2,2,6,6-tetramethyl-3H-pyridin-4-yl)methyl]-9H-fluoren-2-amine;dihydrochloride |
| SMILES | CC1(C)C=C(CNc2ccc3c(c2)Cc2cc(Br)ccc2-3)CC(C)(C)N1O.Cl.Cl |
| InChI | InChI=1S/C23H27BrN2O.2ClH/c1-22(2)12-15(13-23(3,4)26(22)27)14-25-19-6-8-21-17(11-19)9-16-10-18(24)5-7-20(16)21;;/h5-8,10-12,25,27H,9,13-14H2,1-4H3;2*1H |
| InChIKey | NJUGFAXSHZNLJJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.31 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|