About sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate
sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate (PubChem CID 54586954) has the molecular formula C10H8NNaO8S2
and a molecular weight of 357.30 g/mol. Its IUPAC name is sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate.
Molecular Properties
| Compound Name | sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate |
| PubChem CID | 54586954 |
| Molecular Formula | C10H8NNaO8S2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)[O-])cc(O)c2c1O.[Na+] |
| InChI | InChI=1S/C10H9NO8S2.Na/c11-9-7(21(17,18)19)2-4-1-5(20(14,15)16)3-6(12)8(4)10(9)13;/h1-3,12-13H,11H2,(H,14,15,16)(H,17,18,19);/q;+1/p-1 |
| InChIKey | OYHQJZVFSQTOSD-UHFFFAOYSA-M |
| XLogP | -3.01 |
| TPSA | 178.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate?
The IUPAC name of sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate (CID 54586954) is sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate.
What is the SMILES notation for sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate?
The canonical SMILES for sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate is Nc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)[O-])cc(O)c2c1O.[Na+].
What is the InChIKey of sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate?
The InChIKey is OYHQJZVFSQTOSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO8S2.Na/c11-9-7(21(17,18)19)2-4-1-5(20(14,15)16)3-6(12)8(4)10(9)13;/h1-3,12-13H,11H2,(H,14,15,16)(H,17,18,19);/q;+1/p-1.
What are the key properties of sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate?
sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate has a molecular weight of 357.30 g/mol, XLogP of -3.01, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-amino-4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate is sourced from PubChem (CID 54586954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).