C34H47ClN6 — CID 54586979
3,9-dimethyl-1-N,7-N-bis(3-piperidin-1-ylpropyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride (PubChem CID 54586979) has the molecular formula C34H47ClN6 and a molecular weight of 575.25 g/mol. Its IUPAC name is 3,9-dimethyl-1-N,7-N-bis(3-piperidin-1-ylpropyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride.
| Compound Name | 3,9-dimethyl-1-N,7-N-bis(3-piperidin-1-ylpropyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
|---|---|
| PubChem CID | 54586979 |
| Molecular Formula | C34H47ClN6 |
| Molecular Weight | 575.25 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | 3,9-dimethyl-1-N,7-N-bis(3-piperidin-1-ylpropyl)quinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
| SMILES | Cc1cc(NCCCN2CCCCC2)c2ccc3c(ccc4c(NCCCN5CCCCC5)cc(C)nc43)c2n1.Cl |
| InChI | InChI=1S/C34H46N6.ClH/c1-25-23-31(35-15-9-21-39-17-5-3-6-18-39)29-13-12-28-27(33(29)37-25)11-14-30-32(24-26(2)38-34(28)30)36-16-10-22-40-19-7-4-8-20-40;/h11-14,23-24H,3-10,15-22H2,1-2H3,(H,35,37)(H,36,38);1H |
| InChIKey | ROVMOYLTTYUCCJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.25 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|