About 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one
2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one (PubChem CID 54586995) has the molecular formula C16H23NO3S2
and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one.
Molecular Properties
| Compound Name | 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one |
| PubChem CID | 54586995 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one |
| SMILES | CCCCCN1C(=O)CCSC1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H23NO3S2/c1-3-4-5-11-17-15(18)10-12-21-16(17)13-6-8-14(9-7-13)22(2,19)20/h6-9,16H,3-5,10-12H2,1-2H3 |
| InChIKey | VHPQDQVJBTUVDC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one?
The IUPAC name of 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one (CID 54586995) is 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one.
What is the SMILES notation for 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one?
The canonical SMILES for 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one is CCCCCN1C(=O)CCSC1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one?
The InChIKey is VHPQDQVJBTUVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3S2/c1-3-4-5-11-17-15(18)10-12-21-16(17)13-6-8-14(9-7-13)22(2,19)20/h6-9,16H,3-5,10-12H2,1-2H3.
What are the key properties of 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one?
2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one has a molecular weight of 341.50 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylsulfonylphenyl)-3-pentyl-1,3-thiazinan-4-one is sourced from PubChem (CID 54586995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).