C27H34N6O4 — CID 54587002
(6aR,9R,10aR)-9-(1-cyclohexyltetrazol-5-yl)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid (PubChem CID 54587002) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is (6aR,9R,10aR)-9-(1-cyclohexyltetrazol-5-yl)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid.
| Compound Name | (6aR,9R,10aR)-9-(1-cyclohexyltetrazol-5-yl)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 54587002 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (6aR,9R,10aR)-9-(1-cyclohexyltetrazol-5-yl)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline;(Z)-but-2-enedioic acid |
| SMILES | CN1C[C@H](c2nnnn2C2CCCCC2)C[C@@H]2c3cccc4c3c(cn4C)C[C@H]21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H30N6.C4H4O4/c1-27-13-15-12-21-19(18-9-6-10-20(27)22(15)18)11-16(14-28(21)2)23-24-25-26-29(23)17-7-4-3-5-8-17;5-3(6)1-2-4(7)8/h6,9-10,13,16-17,19,21H,3-5,7-8,11-12,14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,19-,21-;/m1./s1 |
| InChIKey | BJLUXPTWIQADGV-BHQRWJJSSA-N |
| XLogP | 3.51 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|