C13H15FN2O3S — CID 54587011
5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 54587011) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 54587011 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-(4-fluorophenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | O=C1CC2CN(S(=O)(=O)c3ccc(F)cc3)CCC2N1 |
| InChI | InChI=1S/C13H15FN2O3S/c14-10-1-3-11(4-2-10)20(18,19)16-6-5-12-9(8-16)7-13(17)15-12/h1-4,9,12H,5-8H2,(H,15,17) |
| InChIKey | NESIHZHQKQDCCC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |