C21H30N2O2 — CID 54587074
[(4R,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylpyrrolidin-3-yl)methanone (PubChem CID 54587074) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(4R,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylpyrrolidin-3-yl)methanone.
| Compound Name | [(4R,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 54587074 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | [(4R,4aS,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1-methylpyrrolidin-3-yl)methanone |
| SMILES | CN1CCC(C(=O)N2CC[C@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)C1 |
| InChI | InChI=1S/C21H30N2O2/c1-22-13-11-16(15-22)20(24)23-14-12-21(25,17-7-3-2-4-8-17)18-9-5-6-10-19(18)23/h2-4,7-8,16,18-19,25H,5-6,9-15H2,1H3/t16?,18-,19-,21-/m0/s1 |
| InChIKey | WJAPFKRDKPDSGT-ZRTMLZEBSA-N |
| XLogP | 2.62 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |