C23H26N2OS — CID 54587102
2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-1-phenothiazin-10-ylethanone (PubChem CID 54587102) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-1-phenothiazin-10-ylethanone.
| Compound Name | 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 54587102 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-1-phenothiazin-10-ylethanone |
| SMILES | O=C(C[C@@H]1CCCN2CCCC[C@H]12)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H26N2OS/c26-23(16-17-8-7-15-24-14-6-5-9-18(17)24)25-19-10-1-3-12-21(19)27-22-13-4-2-11-20(22)25/h1-4,10-13,17-18H,5-9,14-16H2/t17-,18+/m0/s1 |
| InChIKey | VBFVMVZMRAKGBX-ZWKOTPCHSA-N |
| XLogP | 5.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |