C21H24N2O2 — CID 54587107
[(4R,4aS,8aS)-4-hydroxy-4-pyridin-2-yl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone (PubChem CID 54587107) has the molecular formula C21H24N2O2 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(4R,4aS,8aS)-4-hydroxy-4-pyridin-2-yl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone.
| Compound Name | [(4R,4aS,8aS)-4-hydroxy-4-pyridin-2-yl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54587107 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(4R,4aS,8aS)-4-hydroxy-4-pyridin-2-yl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@](O)(c2ccccn2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H24N2O2/c24-20(16-8-2-1-3-9-16)23-15-13-21(25,19-12-6-7-14-22-19)17-10-4-5-11-18(17)23/h1-3,6-9,12,14,17-18,25H,4-5,10-11,13,15H2/t17-,18-,21+/m0/s1 |
| InChIKey | RDTMYWCWQUZGAC-BBTUJRGHSA-N |
| XLogP | 3.37 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |