About 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine
1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine (PubChem CID 54587116) has the molecular formula C13H12BNO2
and a molecular weight of 225.06 g/mol. Its IUPAC name is 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine.
Molecular Properties
| Compound Name | 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine |
| PubChem CID | 54587116 |
| Molecular Formula | C13H12BNO2 |
| Molecular Weight | 225.06 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine |
| SMILES | OB1OCc2ccc(Nc3ccccc3)cc21 |
| InChI | InChI=1S/C13H12BNO2/c16-14-13-8-12(7-6-10(13)9-17-14)15-11-4-2-1-3-5-11/h1-8,15-16H,9H2 |
| InChIKey | CSONLIKZXPICDX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.06 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine?
The IUPAC name of 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine (CID 54587116) is 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine.
What is the SMILES notation for 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine?
The canonical SMILES for 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine is OB1OCc2ccc(Nc3ccccc3)cc21.
What is the InChIKey of 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine?
The InChIKey is CSONLIKZXPICDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BNO2/c16-14-13-8-12(7-6-10(13)9-17-14)15-11-4-2-1-3-5-11/h1-8,15-16H,9H2.
What are the key properties of 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine?
1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine has a molecular weight of 225.06 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-N-phenyl-3H-2,1-benzoxaborol-6-amine is sourced from PubChem (CID 54587116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).