C20H27N3O5 — CID 54587139
2,2-dimethyl-N-phenyl-4-[(5R,6R,7S,8S)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]butanamide (PubChem CID 54587139) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2,2-dimethyl-N-phenyl-4-[(5R,6R,7S,8S)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]butanamide.
| Compound Name | 2,2-dimethyl-N-phenyl-4-[(5R,6R,7S,8S)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]butanamide |
|---|---|
| PubChem CID | 54587139 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2,2-dimethyl-N-phenyl-4-[(5R,6R,7S,8S)-6,7,8-trihydroxy-5-(hydroxymethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]butanamide |
| SMILES | CC(C)(CCc1cn2c(n1)[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H27N3O5/c1-20(2,19(28)22-12-6-4-3-5-7-12)9-8-13-10-23-14(11-24)15(25)16(26)17(27)18(23)21-13/h3-7,10,14-17,24-27H,8-9,11H2,1-2H3,(H,22,28)/t14-,15-,16+,17-/m1/s1 |
| InChIKey | QVQYGHOPKDGDIL-WCXIOVBPSA-N |
| XLogP | 0.78 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |