C19H24N6OS — CID 54587168
3-amino-N-[(E)-[1-[2-(dimethylamino)ethyl]pyrrol-2-yl]methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 54587168) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-amino-N-[(E)-[1-[2-(dimethylamino)ethyl]pyrrol-2-yl]methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-[1-[2-(dimethylamino)ethyl]pyrrol-2-yl]methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54587168 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-amino-N-[(E)-[1-[2-(dimethylamino)ethyl]pyrrol-2-yl]methylideneamino]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)N/N=C/c3cccn3CCN(C)C)sc2n1 |
| InChI | InChI=1S/C19H24N6OS/c1-12-10-13(2)22-19-15(12)16(20)17(27-19)18(26)23-21-11-14-6-5-7-25(14)9-8-24(3)4/h5-7,10-11H,8-9,20H2,1-4H3,(H,23,26)/b21-11+ |
| InChIKey | QXBXQTHNVMBWPH-SRZZPIQSSA-N |
| XLogP | 2.62 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|