About 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide
4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide (PubChem CID 54587229) has the molecular formula C20H21FN4O3
and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide |
| PubChem CID | 54587229 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide |
| SMILES | COc1ccc(OC)c(-c2c(F)ccc3c(N)c(C(=O)NC(C)C)nnc23)c1 |
| InChI | InChI=1S/C20H21FN4O3/c1-10(2)23-20(26)19-17(22)12-6-7-14(21)16(18(12)24-25-19)13-9-11(27-3)5-8-15(13)28-4/h5-10H,1-4H3,(H2,22,24)(H,23,26) |
| InChIKey | MVMSIAOIXGSGIK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide?
The IUPAC name of 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide (CID 54587229) is 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide.
What is the SMILES notation for 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide?
The canonical SMILES for 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide is COc1ccc(OC)c(-c2c(F)ccc3c(N)c(C(=O)NC(C)C)nnc23)c1.
What is the InChIKey of 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide?
The InChIKey is MVMSIAOIXGSGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O3/c1-10(2)23-20(26)19-17(22)12-6-7-14(21)16(18(12)24-25-19)13-9-11(27-3)5-8-15(13)28-4/h5-10H,1-4H3,(H2,22,24)(H,23,26).
What are the key properties of 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide?
4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide has a molecular weight of 384.41 g/mol, XLogP of 3.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-(2,5-dimethoxyphenyl)-7-fluoro-N-propan-2-ylcinnoline-3-carboxamide is sourced from PubChem (CID 54587229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).