About 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine
4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine (PubChem CID 54587542) has the molecular formula C22H22N6O2
and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| PubChem CID | 54587542 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| SMILES | Cn1cc(-c2ncco2)c(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)n1 |
| InChI | InChI=1S/C22H22N6O2/c1-27-15-19(22-24-8-11-30-22)21(26-27)16-6-7-23-20(14-16)25-17-2-4-18(5-3-17)28-9-12-29-13-10-28/h2-8,11,14-15H,9-10,12-13H2,1H3,(H,23,25) |
| InChIKey | FGGCFGLSCSQSEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine?
The IUPAC name of 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine (CID 54587542) is 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine.
What is the SMILES notation for 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine?
The canonical SMILES for 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine is Cn1cc(-c2ncco2)c(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)n1.
What is the InChIKey of 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine?
The InChIKey is FGGCFGLSCSQSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N6O2/c1-27-15-19(22-24-8-11-30-22)21(26-27)16-6-7-23-20(14-16)25-17-2-4-18(5-3-17)28-9-12-29-13-10-28/h2-8,11,14-15H,9-10,12-13H2,1H3,(H,23,25).
What are the key properties of 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine?
4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine has a molecular weight of 402.46 g/mol, XLogP of 3.72, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-methyl-4-(1,3-oxazol-2-yl)pyrazol-3-yl]-N-(4-morpholin-4-ylphenyl)pyridin-2-amine is sourced from PubChem (CID 54587542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).