About 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride
2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride (PubChem CID 54587608) has the molecular formula C15H17BrClNS
and a molecular weight of 358.73 g/mol. Its IUPAC name is 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride |
| PubChem CID | 54587608 |
| Molecular Formula | C15H17BrClNS |
| Molecular Weight | 358.73 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride |
| SMILES | Cc1ccc(C2CN(C)Cc3sc(Br)cc32)cc1.Cl |
| InChI | InChI=1S/C15H16BrNS.ClH/c1-10-3-5-11(6-4-10)13-8-17(2)9-14-12(13)7-15(16)18-14;/h3-7,13H,8-9H2,1-2H3;1H |
| InChIKey | TYSOGLSTCFNAMS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The IUPAC name of 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride (CID 54587608) is 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride.
What is the SMILES notation for 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The canonical SMILES for 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride is Cc1ccc(C2CN(C)Cc3sc(Br)cc32)cc1.Cl.
What is the InChIKey of 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
The InChIKey is TYSOGLSTCFNAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNS.ClH/c1-10-3-5-11(6-4-10)13-8-17(2)9-14-12(13)7-15(16)18-14;/h3-7,13H,8-9H2,1-2H3;1H.
What are the key properties of 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride?
2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride has a molecular weight of 358.73 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methyl-4-(4-methylphenyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine;hydrochloride is sourced from PubChem (CID 54587608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).