About 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea
1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea (PubChem CID 54587610) has the molecular formula C13H9Cl3N2O3S
and a molecular weight of 379.65 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea |
| PubChem CID | 54587610 |
| Molecular Formula | C13H9Cl3N2O3S |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O3S/c14-8-2-1-3-12(7-8)22(20,21)18-13(19)17-11-5-9(15)4-10(16)6-11/h1-7H,(H2,17,18,19) |
| InChIKey | WEPSKTYXYPARSQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea?
The IUPAC name of 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea (CID 54587610) is 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea.
What is the SMILES notation for 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea?
The canonical SMILES for 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea is O=C(Nc1cc(Cl)cc(Cl)c1)NS(=O)(=O)c1cccc(Cl)c1.
What is the InChIKey of 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea?
The InChIKey is WEPSKTYXYPARSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl3N2O3S/c14-8-2-1-3-12(7-8)22(20,21)18-13(19)17-11-5-9(15)4-10(16)6-11/h1-7H,(H2,17,18,19).
What are the key properties of 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea?
1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea has a molecular weight of 379.65 g/mol, XLogP of 4.16, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)sulfonyl-3-(3,5-dichlorophenyl)urea is sourced from PubChem (CID 54587610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).